C18H23N3O3S2 — CID 24687372
2-[(4-methylphenyl)sulfonylamino]-N-(5-methyl-2-pyridinyl)-4-methylsulfanylbutanamide (PubChem CID 24687372) has the molecular formula C18H23N3O3S2 and a molecular weight of 393.53 g/mol. Its IUPAC name is 2-[(4-methylphenyl)sulfonylamino]-N-(5-methyl-2-pyridinyl)-4-methylsulfanylbutanamide.
| Compound Name | 2-[(4-methylphenyl)sulfonylamino]-N-(5-methyl-2-pyridinyl)-4-methylsulfanylbutanamide |
|---|---|
| PubChem CID | 24687372 |
| Molecular Formula | C18H23N3O3S2 |
| Molecular Weight | 393.53 g/mol |
| Exact Mass | 393.12 |
| IUPAC Name | 2-[(4-methylphenyl)sulfonylamino]-N-(5-methyl-2-pyridinyl)-4-methylsulfanylbutanamide |
| SMILES | CSCCC(NS(=O)(=O)c1ccc(C)cc1)C(=O)Nc1ccc(C)cn1 |
| InChI | InChI=1S/C18H23N3O3S2/c1-13-4-7-15(8-5-13)26(23,24)21-16(10-11-25-3)18(22)20-17-9-6-14(2)12-19-17/h4-9,12,16,21H,10-11H2,1-3H3,(H,19,20,22) |
| InChIKey | WDFLDUBJRUJMPY-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.53 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |