C22H25N7O4 — CID 24687403
N-[4-[2-(diethylamino)ethylcarbamoyl]phenyl]-3-nitro-4-(1,2,4-triazol-1-yl)benzamide (PubChem CID 24687403) has the molecular formula C22H25N7O4 and a molecular weight of 451.49 g/mol. Its IUPAC name is N-[4-[2-(diethylamino)ethylcarbamoyl]phenyl]-3-nitro-4-(1,2,4-triazol-1-yl)benzamide.
| Compound Name | N-[4-[2-(diethylamino)ethylcarbamoyl]phenyl]-3-nitro-4-(1,2,4-triazol-1-yl)benzamide |
|---|---|
| PubChem CID | 24687403 |
| Molecular Formula | C22H25N7O4 |
| Molecular Weight | 451.49 g/mol |
| Exact Mass | 451.20 |
| IUPAC Name | N-[4-[2-(diethylamino)ethylcarbamoyl]phenyl]-3-nitro-4-(1,2,4-triazol-1-yl)benzamide |
| SMILES | CCN(CC)CCNC(=O)c1ccc(NC(=O)c2ccc(-n3cncn3)c([N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C22H25N7O4/c1-3-27(4-2)12-11-24-21(30)16-5-8-18(9-6-16)26-22(31)17-7-10-19(20(13-17)29(32)33)28-15-23-14-25-28/h5-10,13-15H,3-4,11-12H2,1-2H3,(H,24,30)(H,26,31) |
| InChIKey | ARQFLMCDWNNOFO-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 135.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.49 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|