C31H36N4O5 — CID 24687474
4-(4-acetylphenoxy)-N-(6-amino-1-benzyl-2,4-dioxopyrimidin-5-yl)-N-[2-(cyclohexen-1-yl)ethyl]butanamide (PubChem CID 24687474) has the molecular formula C31H36N4O5 and a molecular weight of 544.65 g/mol. Its IUPAC name is 4-(4-acetylphenoxy)-N-(6-amino-1-benzyl-2,4-dioxopyrimidin-5-yl)-N-[2-(cyclohexen-1-yl)ethyl]butanamide.
| Compound Name | 4-(4-acetylphenoxy)-N-(6-amino-1-benzyl-2,4-dioxopyrimidin-5-yl)-N-[2-(cyclohexen-1-yl)ethyl]butanamide |
|---|---|
| PubChem CID | 24687474 |
| Molecular Formula | C31H36N4O5 |
| Molecular Weight | 544.65 g/mol |
| Exact Mass | 544.27 |
| IUPAC Name | 4-(4-acetylphenoxy)-N-(6-amino-1-benzyl-2,4-dioxopyrimidin-5-yl)-N-[2-(cyclohexen-1-yl)ethyl]butanamide |
| SMILES | CC(=O)c1ccc(OCCCC(=O)N(CCC2=CCCCC2)c2c(N)n(Cc3ccccc3)c(=O)[nH]c2=O)cc1 |
| InChI | InChI=1S/C31H36N4O5/c1-22(36)25-14-16-26(17-15-25)40-20-8-13-27(37)34(19-18-23-9-4-2-5-10-23)28-29(32)35(31(39)33-30(28)38)21-24-11-6-3-7-12-24/h3,6-7,9,11-12,14-17H,2,4-5,8,10,13,18-21,32H2,1H3,(H,33,38,39) |
| InChIKey | MIBIXIVCKXLICM-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 127.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.65 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|