About [2-[(1,1-dioxothiolan-3-yl)-methylamino]-2-oxoethyl] 2-benzylbenzoate
[2-[(1,1-dioxothiolan-3-yl)-methylamino]-2-oxoethyl] 2-benzylbenzoate (PubChem CID 24687516) has the molecular formula C21H23NO5S
and a molecular weight of 401.48 g/mol. Its IUPAC name is [2-[(1,1-dioxothiolan-3-yl)-methylamino]-2-oxoethyl] 2-benzylbenzoate.
Molecular Properties
| Compound Name | [2-[(1,1-dioxothiolan-3-yl)-methylamino]-2-oxoethyl] 2-benzylbenzoate |
| PubChem CID | 24687516 |
| Molecular Formula | C21H23NO5S |
| Molecular Weight | 401.48 g/mol |
| Exact Mass | 401.13 |
| IUPAC Name | [2-[(1,1-dioxothiolan-3-yl)-methylamino]-2-oxoethyl] 2-benzylbenzoate |
| SMILES | CN(C(=O)COC(=O)c1ccccc1Cc1ccccc1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C21H23NO5S/c1-22(18-11-12-28(25,26)15-18)20(23)14-27-21(24)19-10-6-5-9-17(19)13-16-7-3-2-4-8-16/h2-10,18H,11-15H2,1H3 |
| InChIKey | NQKGIUGNANZJQN-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 401.48 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [2-[(1,1-dioxothiolan-3-yl)-methylamino]-2-oxoethyl] 2-benzylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[(1,1-dioxothiolan-3-yl)-methylamino]-2-oxoethyl] 2-benzylbenzoate?
The IUPAC name of [2-[(1,1-dioxothiolan-3-yl)-methylamino]-2-oxoethyl] 2-benzylbenzoate (CID 24687516) is [2-[(1,1-dioxothiolan-3-yl)-methylamino]-2-oxoethyl] 2-benzylbenzoate.
What is the SMILES notation for [2-[(1,1-dioxothiolan-3-yl)-methylamino]-2-oxoethyl] 2-benzylbenzoate?
The canonical SMILES for [2-[(1,1-dioxothiolan-3-yl)-methylamino]-2-oxoethyl] 2-benzylbenzoate is CN(C(=O)COC(=O)c1ccccc1Cc1ccccc1)C1CCS(=O)(=O)C1.
What is the InChIKey of [2-[(1,1-dioxothiolan-3-yl)-methylamino]-2-oxoethyl] 2-benzylbenzoate?
The InChIKey is NQKGIUGNANZJQN-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H23NO5S/c1-22(18-11-12-28(25,26)15-18)20(23)14-27-21(24)19-10-6-5-9-17(19)13-16-7-3-2-4-8-16/h2-10,18H,11-15H2,1H3.
What are the key properties of [2-[(1,1-dioxothiolan-3-yl)-methylamino]-2-oxoethyl] 2-benzylbenzoate?
[2-[(1,1-dioxothiolan-3-yl)-methylamino]-2-oxoethyl] 2-benzylbenzoate has a molecular weight of 401.48 g/mol, XLogP of 2.08, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[(1,1-dioxothiolan-3-yl)-methylamino]-2-oxoethyl] 2-benzylbenzoate is sourced from PubChem (CID 24687516), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).