About N-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-N-(2-methylpropyl)pyrazine-2-carboxamide
N-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-N-(2-methylpropyl)pyrazine-2-carboxamide (PubChem CID 24687524) has the molecular formula C17H24N6O3
and a molecular weight of 360.42 g/mol. Its IUPAC name is N-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-N-(2-methylpropyl)pyrazine-2-carboxamide.
Molecular Properties
| Compound Name | N-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-N-(2-methylpropyl)pyrazine-2-carboxamide |
| PubChem CID | 24687524 |
| Molecular Formula | C17H24N6O3 |
| Molecular Weight | 360.42 g/mol |
| Exact Mass | 360.19 |
| IUPAC Name | N-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-N-(2-methylpropyl)pyrazine-2-carboxamide |
| SMILES | CCCCn1c(N)c(N(CC(C)C)C(=O)c2cnccn2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C17H24N6O3/c1-4-5-8-22-14(18)13(15(24)21-17(22)26)23(10-11(2)3)16(25)12-9-19-6-7-20-12/h6-7,9,11H,4-5,8,10,18H2,1-3H3,(H,21,24,26) |
| InChIKey | UTIPZNRRGHCXBA-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 126.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 360.42 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze N-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-N-(2-methylpropyl)pyrazine-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-N-(2-methylpropyl)pyrazine-2-carboxamide?
The IUPAC name of N-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-N-(2-methylpropyl)pyrazine-2-carboxamide (CID 24687524) is N-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-N-(2-methylpropyl)pyrazine-2-carboxamide.
What is the SMILES notation for N-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-N-(2-methylpropyl)pyrazine-2-carboxamide?
The canonical SMILES for N-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-N-(2-methylpropyl)pyrazine-2-carboxamide is CCCCn1c(N)c(N(CC(C)C)C(=O)c2cnccn2)c(=O)[nH]c1=O.
What is the InChIKey of N-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-N-(2-methylpropyl)pyrazine-2-carboxamide?
The InChIKey is UTIPZNRRGHCXBA-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H24N6O3/c1-4-5-8-22-14(18)13(15(24)21-17(22)26)23(10-11(2)3)16(25)12-9-19-6-7-20-12/h6-7,9,11H,4-5,8,10,18H2,1-3H3,(H,21,24,26).
What are the key properties of N-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-N-(2-methylpropyl)pyrazine-2-carboxamide?
N-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-N-(2-methylpropyl)pyrazine-2-carboxamide has a molecular weight of 360.42 g/mol, XLogP of 1.01, 7 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for N-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-N-(2-methylpropyl)pyrazine-2-carboxamide is sourced from PubChem (CID 24687524), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).