C26H38N4O6 — CID 24687724
[2-[(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-pentylamino]-2-oxoethyl] 2-(2,4,6-trimethylphenoxy)acetate (PubChem CID 24687724) has the molecular formula C26H38N4O6 and a molecular weight of 502.61 g/mol. Its IUPAC name is [2-[(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-pentylamino]-2-oxoethyl] 2-(2,4,6-trimethylphenoxy)acetate.
| Compound Name | [2-[(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-pentylamino]-2-oxoethyl] 2-(2,4,6-trimethylphenoxy)acetate |
|---|---|
| PubChem CID | 24687724 |
| Molecular Formula | C26H38N4O6 |
| Molecular Weight | 502.61 g/mol |
| Exact Mass | 502.28 |
| IUPAC Name | [2-[(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-pentylamino]-2-oxoethyl] 2-(2,4,6-trimethylphenoxy)acetate |
| SMILES | CCCCCN(C(=O)COC(=O)COc1c(C)cc(C)cc1C)c1c(N)n(CCCC)c(=O)[nH]c1=O |
| InChI | InChI=1S/C26H38N4O6/c1-6-8-10-12-29(22-24(27)30(11-9-7-2)26(34)28-25(22)33)20(31)15-35-21(32)16-36-23-18(4)13-17(3)14-19(23)5/h13-14H,6-12,15-16,27H2,1-5H3,(H,28,33,34) |
| InChIKey | HYZLXCQSLNILHY-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 136.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.61 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|