About [5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]methyl 2-[(4-methylbenzoyl)amino]acetate
[5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]methyl 2-[(4-methylbenzoyl)amino]acetate (PubChem CID 24687737) has the molecular formula C19H16N4O6
and a molecular weight of 396.36 g/mol. Its IUPAC name is [5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]methyl 2-[(4-methylbenzoyl)amino]acetate.
Molecular Properties
| Compound Name | [5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]methyl 2-[(4-methylbenzoyl)amino]acetate |
| PubChem CID | 24687737 |
| Molecular Formula | C19H16N4O6 |
| Molecular Weight | 396.36 g/mol |
| Exact Mass | 396.11 |
| IUPAC Name | [5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]methyl 2-[(4-methylbenzoyl)amino]acetate |
| SMILES | Cc1ccc(C(=O)NCC(=O)OCc2nnc(-c3ccc([N+](=O)[O-])cc3)o2)cc1 |
| InChI | InChI=1S/C19H16N4O6/c1-12-2-4-13(5-3-12)18(25)20-10-17(24)28-11-16-21-22-19(29-16)14-6-8-15(9-7-14)23(26)27/h2-9H,10-11H2,1H3,(H,20,25) |
| InChIKey | IOSFQXRLEYDSAC-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 137.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 396.36 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]methyl 2-[(4-methylbenzoyl)amino]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]methyl 2-[(4-methylbenzoyl)amino]acetate?
The IUPAC name of [5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]methyl 2-[(4-methylbenzoyl)amino]acetate (CID 24687737) is [5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]methyl 2-[(4-methylbenzoyl)amino]acetate.
What is the SMILES notation for [5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]methyl 2-[(4-methylbenzoyl)amino]acetate?
The canonical SMILES for [5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]methyl 2-[(4-methylbenzoyl)amino]acetate is Cc1ccc(C(=O)NCC(=O)OCc2nnc(-c3ccc([N+](=O)[O-])cc3)o2)cc1.
What is the InChIKey of [5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]methyl 2-[(4-methylbenzoyl)amino]acetate?
The InChIKey is IOSFQXRLEYDSAC-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H16N4O6/c1-12-2-4-13(5-3-12)18(25)20-10-17(24)28-11-16-21-22-19(29-16)14-6-8-15(9-7-14)23(26)27/h2-9H,10-11H2,1H3,(H,20,25).
What are the key properties of [5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]methyl 2-[(4-methylbenzoyl)amino]acetate?
[5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]methyl 2-[(4-methylbenzoyl)amino]acetate has a molecular weight of 396.36 g/mol, XLogP of 2.43, 7 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for [5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]methyl 2-[(4-methylbenzoyl)amino]acetate is sourced from PubChem (CID 24687737), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).