C14H12F2N2O2S — CID 24687836
N-[2-(3,4-difluoroanilino)-2-oxoethyl]-2-thiophen-3-ylacetamide (PubChem CID 24687836) has the molecular formula C14H12F2N2O2S and a molecular weight of 310.33 g/mol. Its IUPAC name is N-[2-(3,4-difluoroanilino)-2-oxoethyl]-2-thiophen-3-ylacetamide.
| Compound Name | N-[2-(3,4-difluoroanilino)-2-oxoethyl]-2-thiophen-3-ylacetamide |
|---|---|
| PubChem CID | 24687836 |
| Molecular Formula | C14H12F2N2O2S |
| Molecular Weight | 310.33 g/mol |
| Exact Mass | 310.06 |
| IUPAC Name | N-[2-(3,4-difluoroanilino)-2-oxoethyl]-2-thiophen-3-ylacetamide |
| SMILES | O=C(Cc1ccsc1)NCC(=O)Nc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C14H12F2N2O2S/c15-11-2-1-10(6-12(11)16)18-14(20)7-17-13(19)5-9-3-4-21-8-9/h1-4,6,8H,5,7H2,(H,17,19)(H,18,20) |
| InChIKey | HISFLTSSCQYCQB-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.33 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |