About [2-[2,5-dimethyl-1-(oxolan-2-ylmethyl)pyrrol-3-yl]-2-oxoethyl] 4-chloro-3-sulfamoylbenzoate
[2-[2,5-dimethyl-1-(oxolan-2-ylmethyl)pyrrol-3-yl]-2-oxoethyl] 4-chloro-3-sulfamoylbenzoate (PubChem CID 24687912) has the molecular formula C20H23ClN2O6S
and a molecular weight of 454.93 g/mol. Its IUPAC name is [2-[2,5-dimethyl-1-(oxolan-2-ylmethyl)pyrrol-3-yl]-2-oxoethyl] 4-chloro-3-sulfamoylbenzoate.
Molecular Properties
| Compound Name | [2-[2,5-dimethyl-1-(oxolan-2-ylmethyl)pyrrol-3-yl]-2-oxoethyl] 4-chloro-3-sulfamoylbenzoate |
| PubChem CID | 24687912 |
| Molecular Formula | C20H23ClN2O6S |
| Molecular Weight | 454.93 g/mol |
| Exact Mass | 454.10 |
| IUPAC Name | [2-[2,5-dimethyl-1-(oxolan-2-ylmethyl)pyrrol-3-yl]-2-oxoethyl] 4-chloro-3-sulfamoylbenzoate |
| SMILES | Cc1cc(C(=O)COC(=O)c2ccc(Cl)c(S(N)(=O)=O)c2)c(C)n1CC1CCCO1 |
| InChI | InChI=1S/C20H23ClN2O6S/c1-12-8-16(13(2)23(12)10-15-4-3-7-28-15)18(24)11-29-20(25)14-5-6-17(21)19(9-14)30(22,26)27/h5-6,8-9,15H,3-4,7,10-11H2,1-2H3,(H2,22,26,27) |
| InChIKey | BWKQDSAKZKLKNK-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 117.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 454.93 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze [2-[2,5-dimethyl-1-(oxolan-2-ylmethyl)pyrrol-3-yl]-2-oxoethyl] 4-chloro-3-sulfamoylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[2,5-dimethyl-1-(oxolan-2-ylmethyl)pyrrol-3-yl]-2-oxoethyl] 4-chloro-3-sulfamoylbenzoate?
The IUPAC name of [2-[2,5-dimethyl-1-(oxolan-2-ylmethyl)pyrrol-3-yl]-2-oxoethyl] 4-chloro-3-sulfamoylbenzoate (CID 24687912) is [2-[2,5-dimethyl-1-(oxolan-2-ylmethyl)pyrrol-3-yl]-2-oxoethyl] 4-chloro-3-sulfamoylbenzoate.
What is the SMILES notation for [2-[2,5-dimethyl-1-(oxolan-2-ylmethyl)pyrrol-3-yl]-2-oxoethyl] 4-chloro-3-sulfamoylbenzoate?
The canonical SMILES for [2-[2,5-dimethyl-1-(oxolan-2-ylmethyl)pyrrol-3-yl]-2-oxoethyl] 4-chloro-3-sulfamoylbenzoate is Cc1cc(C(=O)COC(=O)c2ccc(Cl)c(S(N)(=O)=O)c2)c(C)n1CC1CCCO1.
What is the InChIKey of [2-[2,5-dimethyl-1-(oxolan-2-ylmethyl)pyrrol-3-yl]-2-oxoethyl] 4-chloro-3-sulfamoylbenzoate?
The InChIKey is BWKQDSAKZKLKNK-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H23ClN2O6S/c1-12-8-16(13(2)23(12)10-15-4-3-7-28-15)18(24)11-29-20(25)14-5-6-17(21)19(9-14)30(22,26)27/h5-6,8-9,15H,3-4,7,10-11H2,1-2H3,(H2,22,26,27).
What are the key properties of [2-[2,5-dimethyl-1-(oxolan-2-ylmethyl)pyrrol-3-yl]-2-oxoethyl] 4-chloro-3-sulfamoylbenzoate?
[2-[2,5-dimethyl-1-(oxolan-2-ylmethyl)pyrrol-3-yl]-2-oxoethyl] 4-chloro-3-sulfamoylbenzoate has a molecular weight of 454.93 g/mol, XLogP of 2.62, 7 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[2,5-dimethyl-1-(oxolan-2-ylmethyl)pyrrol-3-yl]-2-oxoethyl] 4-chloro-3-sulfamoylbenzoate is sourced from PubChem (CID 24687912), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).