About 3-acetamido-N-[2-(1,2,4-triazol-1-yl)-5-(trifluoromethyl)phenyl]benzamide
3-acetamido-N-[2-(1,2,4-triazol-1-yl)-5-(trifluoromethyl)phenyl]benzamide (PubChem CID 24688109) has the molecular formula C18H14F3N5O2
and a molecular weight of 389.34 g/mol. Its IUPAC name is 3-acetamido-N-[2-(1,2,4-triazol-1-yl)-5-(trifluoromethyl)phenyl]benzamide.
Molecular Properties
| Compound Name | 3-acetamido-N-[2-(1,2,4-triazol-1-yl)-5-(trifluoromethyl)phenyl]benzamide |
| PubChem CID | 24688109 |
| Molecular Formula | C18H14F3N5O2 |
| Molecular Weight | 389.34 g/mol |
| Exact Mass | 389.11 |
| IUPAC Name | 3-acetamido-N-[2-(1,2,4-triazol-1-yl)-5-(trifluoromethyl)phenyl]benzamide |
| SMILES | CC(=O)Nc1cccc(C(=O)Nc2cc(C(F)(F)F)ccc2-n2cncn2)c1 |
| InChI | InChI=1S/C18H14F3N5O2/c1-11(27)24-14-4-2-3-12(7-14)17(28)25-15-8-13(18(19,20)21)5-6-16(15)26-10-22-9-23-26/h2-10H,1H3,(H,24,27)(H,25,28) |
| InChIKey | PTCIHMGBEVBVTO-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 88.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 389.34 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-acetamido-N-[2-(1,2,4-triazol-1-yl)-5-(trifluoromethyl)phenyl]benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-acetamido-N-[2-(1,2,4-triazol-1-yl)-5-(trifluoromethyl)phenyl]benzamide?
The IUPAC name of 3-acetamido-N-[2-(1,2,4-triazol-1-yl)-5-(trifluoromethyl)phenyl]benzamide (CID 24688109) is 3-acetamido-N-[2-(1,2,4-triazol-1-yl)-5-(trifluoromethyl)phenyl]benzamide.
What is the SMILES notation for 3-acetamido-N-[2-(1,2,4-triazol-1-yl)-5-(trifluoromethyl)phenyl]benzamide?
The canonical SMILES for 3-acetamido-N-[2-(1,2,4-triazol-1-yl)-5-(trifluoromethyl)phenyl]benzamide is CC(=O)Nc1cccc(C(=O)Nc2cc(C(F)(F)F)ccc2-n2cncn2)c1.
What is the InChIKey of 3-acetamido-N-[2-(1,2,4-triazol-1-yl)-5-(trifluoromethyl)phenyl]benzamide?
The InChIKey is PTCIHMGBEVBVTO-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H14F3N5O2/c1-11(27)24-14-4-2-3-12(7-14)17(28)25-15-8-13(18(19,20)21)5-6-16(15)26-10-22-9-23-26/h2-10H,1H3,(H,24,27)(H,25,28).
What are the key properties of 3-acetamido-N-[2-(1,2,4-triazol-1-yl)-5-(trifluoromethyl)phenyl]benzamide?
3-acetamido-N-[2-(1,2,4-triazol-1-yl)-5-(trifluoromethyl)phenyl]benzamide has a molecular weight of 389.34 g/mol, XLogP of 3.50, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-acetamido-N-[2-(1,2,4-triazol-1-yl)-5-(trifluoromethyl)phenyl]benzamide is sourced from PubChem (CID 24688109), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).