About [3-(1,1-dioxo-1,2-thiazolidin-2-yl)phenyl]methanamine
[3-(1,1-dioxo-1,2-thiazolidin-2-yl)phenyl]methanamine (PubChem CID 24688479) has the molecular formula C10H14N2O2S
and a molecular weight of 226.30 g/mol. Its IUPAC name is [3-(1,1-dioxo-1,2-thiazolidin-2-yl)phenyl]methanamine.
Molecular Properties
| Compound Name | [3-(1,1-dioxo-1,2-thiazolidin-2-yl)phenyl]methanamine |
| PubChem CID | 24688479 |
| Molecular Formula | C10H14N2O2S |
| Molecular Weight | 226.30 g/mol |
| Exact Mass | 226.08 |
| IUPAC Name | [3-(1,1-dioxo-1,2-thiazolidin-2-yl)phenyl]methanamine |
| SMILES | NCc1cccc(N2CCCS2(=O)=O)c1 |
| InChI | InChI=1S/C10H14N2O2S/c11-8-9-3-1-4-10(7-9)12-5-2-6-15(12,13)14/h1,3-4,7H,2,5-6,8,11H2 |
| InChIKey | FSNIHYOXNQICHK-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.30 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [3-(1,1-dioxo-1,2-thiazolidin-2-yl)phenyl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(1,1-dioxo-1,2-thiazolidin-2-yl)phenyl]methanamine?
The IUPAC name of [3-(1,1-dioxo-1,2-thiazolidin-2-yl)phenyl]methanamine (CID 24688479) is [3-(1,1-dioxo-1,2-thiazolidin-2-yl)phenyl]methanamine.
What is the SMILES notation for [3-(1,1-dioxo-1,2-thiazolidin-2-yl)phenyl]methanamine?
The canonical SMILES for [3-(1,1-dioxo-1,2-thiazolidin-2-yl)phenyl]methanamine is NCc1cccc(N2CCCS2(=O)=O)c1.
What is the InChIKey of [3-(1,1-dioxo-1,2-thiazolidin-2-yl)phenyl]methanamine?
The InChIKey is FSNIHYOXNQICHK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N2O2S/c11-8-9-3-1-4-10(7-9)12-5-2-6-15(12,13)14/h1,3-4,7H,2,5-6,8,11H2.
What are the key properties of [3-(1,1-dioxo-1,2-thiazolidin-2-yl)phenyl]methanamine?
[3-(1,1-dioxo-1,2-thiazolidin-2-yl)phenyl]methanamine has a molecular weight of 226.30 g/mol, XLogP of 0.69, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(1,1-dioxo-1,2-thiazolidin-2-yl)phenyl]methanamine is sourced from PubChem (CID 24688479), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).