C15H16BrNO2 — CID 24688594
(2-bromophenyl)-(3,4-dimethoxyphenyl)methanamine (PubChem CID 24688594) has the molecular formula C15H16BrNO2 and a molecular weight of 322.20 g/mol. Its IUPAC name is (2-bromophenyl)-(3,4-dimethoxyphenyl)methanamine.
| Compound Name | (2-bromophenyl)-(3,4-dimethoxyphenyl)methanamine |
|---|---|
| PubChem CID | 24688594 |
| Molecular Formula | C15H16BrNO2 |
| Molecular Weight | 322.20 g/mol |
| Exact Mass | 321.04 |
| IUPAC Name | (2-bromophenyl)-(3,4-dimethoxyphenyl)methanamine |
| SMILES | COc1ccc(C(N)c2ccccc2Br)cc1OC |
| InChI | InChI=1S/C15H16BrNO2/c1-18-13-8-7-10(9-14(13)19-2)15(17)11-5-3-4-6-12(11)16/h3-9,15H,17H2,1-2H3 |
| InChIKey | XLHYSQDGSBUWKE-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.20 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |