C11H14ClNO3S — CID 24688623
4-[(butanoylamino)methyl]benzenesulfonyl chloride (PubChem CID 24688623) has the molecular formula C11H14ClNO3S and a molecular weight of 275.76 g/mol. Its IUPAC name is 4-[(butanoylamino)methyl]benzenesulfonyl chloride.
| Compound Name | 4-[(butanoylamino)methyl]benzenesulfonyl chloride |
|---|---|
| PubChem CID | 24688623 |
| Molecular Formula | C11H14ClNO3S |
| Molecular Weight | 275.76 g/mol |
| Exact Mass | 275.04 |
| IUPAC Name | 4-[(butanoylamino)methyl]benzenesulfonyl chloride |
| SMILES | CCCC(=O)NCc1ccc(S(=O)(=O)Cl)cc1 |
| InChI | InChI=1S/C11H14ClNO3S/c1-2-3-11(14)13-8-9-4-6-10(7-5-9)17(12,15)16/h4-7H,2-3,8H2,1H3,(H,13,14) |
| InChIKey | GDVJSHONWUUMTE-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.76 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |