About 5-[2-(2,2-dimethylpropanoylamino)ethyl]thiophene-2-sulfonyl chloride
5-[2-(2,2-dimethylpropanoylamino)ethyl]thiophene-2-sulfonyl chloride (PubChem CID 24688786) has the molecular formula C11H16ClNO3S2
and a molecular weight of 309.84 g/mol. Its IUPAC name is 5-[2-(2,2-dimethylpropanoylamino)ethyl]thiophene-2-sulfonyl chloride.
Molecular Properties
| Compound Name | 5-[2-(2,2-dimethylpropanoylamino)ethyl]thiophene-2-sulfonyl chloride |
| PubChem CID | 24688786 |
| Molecular Formula | C11H16ClNO3S2 |
| Molecular Weight | 309.84 g/mol |
| Exact Mass | 309.03 |
| IUPAC Name | 5-[2-(2,2-dimethylpropanoylamino)ethyl]thiophene-2-sulfonyl chloride |
| SMILES | CC(C)(C)C(=O)NCCc1ccc(S(=O)(=O)Cl)s1 |
| InChI | InChI=1S/C11H16ClNO3S2/c1-11(2,3)10(14)13-7-6-8-4-5-9(17-8)18(12,15)16/h4-5H,6-7H2,1-3H3,(H,13,14) |
| InChIKey | CJBVZTQMDCRUJG-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.84 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-[2-(2,2-dimethylpropanoylamino)ethyl]thiophene-2-sulfonyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[2-(2,2-dimethylpropanoylamino)ethyl]thiophene-2-sulfonyl chloride?
The IUPAC name of 5-[2-(2,2-dimethylpropanoylamino)ethyl]thiophene-2-sulfonyl chloride (CID 24688786) is 5-[2-(2,2-dimethylpropanoylamino)ethyl]thiophene-2-sulfonyl chloride.
What is the SMILES notation for 5-[2-(2,2-dimethylpropanoylamino)ethyl]thiophene-2-sulfonyl chloride?
The canonical SMILES for 5-[2-(2,2-dimethylpropanoylamino)ethyl]thiophene-2-sulfonyl chloride is CC(C)(C)C(=O)NCCc1ccc(S(=O)(=O)Cl)s1.
What is the InChIKey of 5-[2-(2,2-dimethylpropanoylamino)ethyl]thiophene-2-sulfonyl chloride?
The InChIKey is CJBVZTQMDCRUJG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16ClNO3S2/c1-11(2,3)10(14)13-7-6-8-4-5-9(17-8)18(12,15)16/h4-5H,6-7H2,1-3H3,(H,13,14).
What are the key properties of 5-[2-(2,2-dimethylpropanoylamino)ethyl]thiophene-2-sulfonyl chloride?
5-[2-(2,2-dimethylpropanoylamino)ethyl]thiophene-2-sulfonyl chloride has a molecular weight of 309.84 g/mol, XLogP of 2.38, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[2-(2,2-dimethylpropanoylamino)ethyl]thiophene-2-sulfonyl chloride is sourced from PubChem (CID 24688786), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).