About 2-bromo-4-fluoro-N,N-dimethylbenzamide
2-bromo-4-fluoro-N,N-dimethylbenzamide (PubChem CID 24689405) has the molecular formula C9H9BrFNO
and a molecular weight of 246.08 g/mol. Its IUPAC name is 2-bromo-4-fluoro-N,N-dimethylbenzamide.
Molecular Properties
| Compound Name | 2-bromo-4-fluoro-N,N-dimethylbenzamide |
| PubChem CID | 24689405 |
| Molecular Formula | C9H9BrFNO |
| Molecular Weight | 246.08 g/mol |
| Exact Mass | 244.99 |
| IUPAC Name | 2-bromo-4-fluoro-N,N-dimethylbenzamide |
| SMILES | CN(C)C(=O)c1ccc(F)cc1Br |
| InChI | InChI=1S/C9H9BrFNO/c1-12(2)9(13)7-4-3-6(11)5-8(7)10/h3-5H,1-2H3 |
| InChIKey | CGUIJOTZYHWBSQ-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.08 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-bromo-4-fluoro-N,N-dimethylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-4-fluoro-N,N-dimethylbenzamide?
The IUPAC name of 2-bromo-4-fluoro-N,N-dimethylbenzamide (CID 24689405) is 2-bromo-4-fluoro-N,N-dimethylbenzamide.
What is the SMILES notation for 2-bromo-4-fluoro-N,N-dimethylbenzamide?
The canonical SMILES for 2-bromo-4-fluoro-N,N-dimethylbenzamide is CN(C)C(=O)c1ccc(F)cc1Br.
What is the InChIKey of 2-bromo-4-fluoro-N,N-dimethylbenzamide?
The InChIKey is CGUIJOTZYHWBSQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9BrFNO/c1-12(2)9(13)7-4-3-6(11)5-8(7)10/h3-5H,1-2H3.
What are the key properties of 2-bromo-4-fluoro-N,N-dimethylbenzamide?
2-bromo-4-fluoro-N,N-dimethylbenzamide has a molecular weight of 246.08 g/mol, XLogP of 2.29, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-4-fluoro-N,N-dimethylbenzamide is sourced from PubChem (CID 24689405), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).