About (7-bromo-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl 1,3-benzodioxole-5-carboxylate
(7-bromo-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl 1,3-benzodioxole-5-carboxylate (PubChem CID 2469055) has the molecular formula C17H11BrN2O5
and a molecular weight of 403.19 g/mol. Its IUPAC name is (7-bromo-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl 1,3-benzodioxole-5-carboxylate.
Molecular Properties
| Compound Name | (7-bromo-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl 1,3-benzodioxole-5-carboxylate |
| PubChem CID | 2469055 |
| Molecular Formula | C17H11BrN2O5 |
| Molecular Weight | 403.19 g/mol |
| Exact Mass | 401.99 |
| IUPAC Name | (7-bromo-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl 1,3-benzodioxole-5-carboxylate |
| SMILES | O=C(OCc1cc(=O)n2cc(Br)ccc2n1)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C17H11BrN2O5/c18-11-2-4-15-19-12(6-16(21)20(15)7-11)8-23-17(22)10-1-3-13-14(5-10)25-9-24-13/h1-7H,8-9H2 |
| InChIKey | WEXWSVKNBRASNQ-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 79.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 403.19 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze (7-bromo-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl 1,3-benzodioxole-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (7-bromo-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl 1,3-benzodioxole-5-carboxylate?
The IUPAC name of (7-bromo-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl 1,3-benzodioxole-5-carboxylate (CID 2469055) is (7-bromo-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl 1,3-benzodioxole-5-carboxylate.
What is the SMILES notation for (7-bromo-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl 1,3-benzodioxole-5-carboxylate?
The canonical SMILES for (7-bromo-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl 1,3-benzodioxole-5-carboxylate is O=C(OCc1cc(=O)n2cc(Br)ccc2n1)c1ccc2c(c1)OCO2.
What is the InChIKey of (7-bromo-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl 1,3-benzodioxole-5-carboxylate?
The InChIKey is WEXWSVKNBRASNQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H11BrN2O5/c18-11-2-4-15-19-12(6-16(21)20(15)7-11)8-23-17(22)10-1-3-13-14(5-10)25-9-24-13/h1-7H,8-9H2.
What are the key properties of (7-bromo-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl 1,3-benzodioxole-5-carboxylate?
(7-bromo-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl 1,3-benzodioxole-5-carboxylate has a molecular weight of 403.19 g/mol, XLogP of 2.54, 3 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for (7-bromo-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl 1,3-benzodioxole-5-carboxylate is sourced from PubChem (CID 2469055), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).