C24H26N2O2S3 — CID 2469060
2-[[5-[2-oxo-2-(2,4,6-trimethylphenyl)ethyl]sulfanyl-1,3,4-thiadiazol-2-yl]sulfanyl]-1-(2,4,6-trimethylphenyl)ethanone (PubChem CID 2469060) has the molecular formula C24H26N2O2S3 and a molecular weight of 470.69 g/mol. Its IUPAC name is 2-[[5-[2-oxo-2-(2,4,6-trimethylphenyl)ethyl]sulfanyl-1,3,4-thiadiazol-2-yl]sulfanyl]-1-(2,4,6-trimethylphenyl)ethanone.
| Compound Name | 2-[[5-[2-oxo-2-(2,4,6-trimethylphenyl)ethyl]sulfanyl-1,3,4-thiadiazol-2-yl]sulfanyl]-1-(2,4,6-trimethylphenyl)ethanone |
|---|---|
| PubChem CID | 2469060 |
| Molecular Formula | C24H26N2O2S3 |
| Molecular Weight | 470.69 g/mol |
| Exact Mass | 470.12 |
| IUPAC Name | 2-[[5-[2-oxo-2-(2,4,6-trimethylphenyl)ethyl]sulfanyl-1,3,4-thiadiazol-2-yl]sulfanyl]-1-(2,4,6-trimethylphenyl)ethanone |
| SMILES | Cc1cc(C)c(C(=O)CSc2nnc(SCC(=O)c3c(C)cc(C)cc3C)s2)c(C)c1 |
| InChI | InChI=1S/C24H26N2O2S3/c1-13-7-15(3)21(16(4)8-13)19(27)11-29-23-25-26-24(31-23)30-12-20(28)22-17(5)9-14(2)10-18(22)6/h7-10H,11-12H2,1-6H3 |
| InChIKey | MCKLBBIJZKMJOC-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 59.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.69 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |