About 4-amino-2,3-dihydrothiochromene-4-carboxylic acid
4-amino-2,3-dihydrothiochromene-4-carboxylic acid (PubChem CID 24691236) has the molecular formula C10H11NO2S
and a molecular weight of 209.27 g/mol. Its IUPAC name is 4-amino-2,3-dihydrothiochromene-4-carboxylic acid.
Molecular Properties
| Compound Name | 4-amino-2,3-dihydrothiochromene-4-carboxylic acid |
| PubChem CID | 24691236 |
| Molecular Formula | C10H11NO2S |
| Molecular Weight | 209.27 g/mol |
| Exact Mass | 209.05 |
| IUPAC Name | 4-amino-2,3-dihydrothiochromene-4-carboxylic acid |
| SMILES | NC1(C(=O)O)CCSc2ccccc21 |
| InChI | InChI=1S/C10H11NO2S/c11-10(9(12)13)5-6-14-8-4-2-1-3-7(8)10/h1-4H,5-6,11H2,(H,12,13) |
| InChIKey | UIMIEZQZDHXAKD-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.27 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-amino-2,3-dihydrothiochromene-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-2,3-dihydrothiochromene-4-carboxylic acid?
The IUPAC name of 4-amino-2,3-dihydrothiochromene-4-carboxylic acid (CID 24691236) is 4-amino-2,3-dihydrothiochromene-4-carboxylic acid.
What is the SMILES notation for 4-amino-2,3-dihydrothiochromene-4-carboxylic acid?
The canonical SMILES for 4-amino-2,3-dihydrothiochromene-4-carboxylic acid is NC1(C(=O)O)CCSc2ccccc21.
What is the InChIKey of 4-amino-2,3-dihydrothiochromene-4-carboxylic acid?
The InChIKey is UIMIEZQZDHXAKD-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11NO2S/c11-10(9(12)13)5-6-14-8-4-2-1-3-7(8)10/h1-4H,5-6,11H2,(H,12,13).
What are the key properties of 4-amino-2,3-dihydrothiochromene-4-carboxylic acid?
4-amino-2,3-dihydrothiochromene-4-carboxylic acid has a molecular weight of 209.27 g/mol, XLogP of 1.42, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-2,3-dihydrothiochromene-4-carboxylic acid is sourced from PubChem (CID 24691236), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).