C13H11N3O5 — CID 24691581
2-[(2,4-dioxo-1H-pyrimidine-6-carbonyl)-methylamino]benzoic acid (PubChem CID 24691581) has the molecular formula C13H11N3O5 and a molecular weight of 289.25 g/mol. Its IUPAC name is 2-[(2,4-dioxo-1H-pyrimidine-6-carbonyl)-methylamino]benzoic acid.
| Compound Name | 2-[(2,4-dioxo-1H-pyrimidine-6-carbonyl)-methylamino]benzoic acid |
|---|---|
| PubChem CID | 24691581 |
| Molecular Formula | C13H11N3O5 |
| Molecular Weight | 289.25 g/mol |
| Exact Mass | 289.07 |
| IUPAC Name | 2-[(2,4-dioxo-1H-pyrimidine-6-carbonyl)-methylamino]benzoic acid |
| SMILES | CN(C(=O)c1cc(=O)[nH]c(=O)[nH]1)c1ccccc1C(=O)O |
| InChI | InChI=1S/C13H11N3O5/c1-16(9-5-3-2-4-7(9)12(19)20)11(18)8-6-10(17)15-13(21)14-8/h2-6H,1H3,(H,19,20)(H2,14,15,17,21) |
| InChIKey | CTHNARQLFSHHQJ-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 123.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.25 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |