2-(1-methylpyrazol-4-yl)-2-oxoacetic acid

C6H6N2O3 — CID 24691719

IUPAC2-(1-methylpyrazol-4-yl)-2-oxoacetic acid
SMILESCn1cc(C(=O)C(=O)O)cn1
InChIInChI=1S/C6H6N2O3/c1-8-3-4(2-7-8)5(9)6(10)11/h2-3H,1H3,(H,10,11)
InChIKeyAIURWSUYOAFKMN-UHFFFAOYSA-N
MW154.12 g/mol
LogP-0.31
Rot. Bonds2

About 2-(1-methylpyrazol-4-yl)-2-oxoacetic acid

2-(1-methylpyrazol-4-yl)-2-oxoacetic acid (PubChem CID 24691719) has the molecular formula C6H6N2O3 and a molecular weight of 154.12 g/mol. Its IUPAC name is 2-(1-methylpyrazol-4-yl)-2-oxoacetic acid.

Molecular Properties

Compound Name2-(1-methylpyrazol-4-yl)-2-oxoacetic acid
PubChem CID24691719
Molecular FormulaC6H6N2O3
Molecular Weight154.12 g/mol
Exact Mass154.04
IUPAC Name2-(1-methylpyrazol-4-yl)-2-oxoacetic acid
SMILESCn1cc(C(=O)C(=O)O)cn1
InChIInChI=1S/C6H6N2O3/c1-8-3-4(2-7-8)5(9)6(10)11/h2-3H,1H3,(H,10,11)
InChIKeyAIURWSUYOAFKMN-UHFFFAOYSA-N
XLogP-0.31
TPSA72.19 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms11
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500154.12
LogP ≤ 5-0.31
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'diketo_group', 'substructure': 'N/A'}

Analyze 2-(1-methylpyrazol-4-yl)-2-oxoacetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(1-methylpyrazol-4-yl)-2-oxoacetic acid?
The IUPAC name of 2-(1-methylpyrazol-4-yl)-2-oxoacetic acid (CID 24691719) is 2-(1-methylpyrazol-4-yl)-2-oxoacetic acid.
What is the SMILES notation for 2-(1-methylpyrazol-4-yl)-2-oxoacetic acid?
The canonical SMILES for 2-(1-methylpyrazol-4-yl)-2-oxoacetic acid is Cn1cc(C(=O)C(=O)O)cn1.
What is the InChIKey of 2-(1-methylpyrazol-4-yl)-2-oxoacetic acid?
The InChIKey is AIURWSUYOAFKMN-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6N2O3/c1-8-3-4(2-7-8)5(9)6(10)11/h2-3H,1H3,(H,10,11).
What are the key properties of 2-(1-methylpyrazol-4-yl)-2-oxoacetic acid?
2-(1-methylpyrazol-4-yl)-2-oxoacetic acid has a molecular weight of 154.12 g/mol, XLogP of -0.31, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1-methylpyrazol-4-yl)-2-oxoacetic acid is sourced from PubChem (CID 24691719), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).