C11H16N2O — CID 24691874
3-amino-N,N-dimethyl-3-phenylpropanamide (PubChem CID 24691874) has the molecular formula C11H16N2O and a molecular weight of 192.26 g/mol. Its IUPAC name is 3-amino-N,N-dimethyl-3-phenylpropanamide.
| Compound Name | 3-amino-N,N-dimethyl-3-phenylpropanamide |
|---|---|
| PubChem CID | 24691874 |
| Molecular Formula | C11H16N2O |
| Molecular Weight | 192.26 g/mol |
| Exact Mass | 192.13 |
| IUPAC Name | 3-amino-N,N-dimethyl-3-phenylpropanamide |
| SMILES | CN(C)C(=O)CC(N)c1ccccc1 |
| InChI | InChI=1S/C11H16N2O/c1-13(2)11(14)8-10(12)9-6-4-3-5-7-9/h3-7,10H,8,12H2,1-2H3 |
| InChIKey | DMNMWGMDLPLQAL-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.26 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |