C15H22N2 — CID 24692606
2-methyl-1-(piperidin-2-ylmethyl)-2,3-dihydroindole (PubChem CID 24692606) has the molecular formula C15H22N2 and a molecular weight of 230.35 g/mol. Its IUPAC name is 2-methyl-1-(piperidin-2-ylmethyl)-2,3-dihydroindole.
| Compound Name | 2-methyl-1-(piperidin-2-ylmethyl)-2,3-dihydroindole |
|---|---|
| PubChem CID | 24692606 |
| Molecular Formula | C15H22N2 |
| Molecular Weight | 230.35 g/mol |
| Exact Mass | 230.18 |
| IUPAC Name | 2-methyl-1-(piperidin-2-ylmethyl)-2,3-dihydroindole |
| SMILES | CC1Cc2ccccc2N1CC1CCCCN1 |
| InChI | InChI=1S/C15H22N2/c1-12-10-13-6-2-3-8-15(13)17(12)11-14-7-4-5-9-16-14/h2-3,6,8,12,14,16H,4-5,7,9-11H2,1H3 |
| InChIKey | DXZSFEDMTJMZTC-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.35 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |