About 2-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]pyridine-4-carbonitrile
2-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]pyridine-4-carbonitrile (PubChem CID 24692698) has the molecular formula C15H11N3O2
and a molecular weight of 265.27 g/mol. Its IUPAC name is 2-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]pyridine-4-carbonitrile.
Molecular Properties
| Compound Name | 2-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]pyridine-4-carbonitrile |
| PubChem CID | 24692698 |
| Molecular Formula | C15H11N3O2 |
| Molecular Weight | 265.27 g/mol |
| Exact Mass | 265.09 |
| IUPAC Name | 2-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]pyridine-4-carbonitrile |
| SMILES | N#Cc1ccnc(Oc2ccc3c(c2)CCC(=O)N3)c1 |
| InChI | InChI=1S/C15H11N3O2/c16-9-10-5-6-17-15(7-10)20-12-2-3-13-11(8-12)1-4-14(19)18-13/h2-3,5-8H,1,4H2,(H,18,19) |
| InChIKey | LBIYZUTVZCIVGO-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 75.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.27 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]pyridine-4-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]pyridine-4-carbonitrile?
The IUPAC name of 2-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]pyridine-4-carbonitrile (CID 24692698) is 2-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]pyridine-4-carbonitrile.
What is the SMILES notation for 2-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]pyridine-4-carbonitrile?
The canonical SMILES for 2-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]pyridine-4-carbonitrile is N#Cc1ccnc(Oc2ccc3c(c2)CCC(=O)N3)c1.
What is the InChIKey of 2-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]pyridine-4-carbonitrile?
The InChIKey is LBIYZUTVZCIVGO-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H11N3O2/c16-9-10-5-6-17-15(7-10)20-12-2-3-13-11(8-12)1-4-14(19)18-13/h2-3,5-8H,1,4H2,(H,18,19).
What are the key properties of 2-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]pyridine-4-carbonitrile?
2-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]pyridine-4-carbonitrile has a molecular weight of 265.27 g/mol, XLogP of 2.63, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]pyridine-4-carbonitrile is sourced from PubChem (CID 24692698), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).