About N-(oxolan-2-ylmethyl)-1,3-thiazolidine-4-carboxamide
N-(oxolan-2-ylmethyl)-1,3-thiazolidine-4-carboxamide (PubChem CID 24692901) has the molecular formula C9H16N2O2S
and a molecular weight of 216.31 g/mol. Its IUPAC name is N-(oxolan-2-ylmethyl)-1,3-thiazolidine-4-carboxamide.
Molecular Properties
| Compound Name | N-(oxolan-2-ylmethyl)-1,3-thiazolidine-4-carboxamide |
| PubChem CID | 24692901 |
| Molecular Formula | C9H16N2O2S |
| Molecular Weight | 216.31 g/mol |
| Exact Mass | 216.09 |
| IUPAC Name | N-(oxolan-2-ylmethyl)-1,3-thiazolidine-4-carboxamide |
| SMILES | O=C(NCC1CCCO1)C1CSCN1 |
| InChI | InChI=1S/C9H16N2O2S/c12-9(8-5-14-6-11-8)10-4-7-2-1-3-13-7/h7-8,11H,1-6H2,(H,10,12) |
| InChIKey | KHIARCRYNJZXAG-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.31 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(oxolan-2-ylmethyl)-1,3-thiazolidine-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(oxolan-2-ylmethyl)-1,3-thiazolidine-4-carboxamide?
The IUPAC name of N-(oxolan-2-ylmethyl)-1,3-thiazolidine-4-carboxamide (CID 24692901) is N-(oxolan-2-ylmethyl)-1,3-thiazolidine-4-carboxamide.
What is the SMILES notation for N-(oxolan-2-ylmethyl)-1,3-thiazolidine-4-carboxamide?
The canonical SMILES for N-(oxolan-2-ylmethyl)-1,3-thiazolidine-4-carboxamide is O=C(NCC1CCCO1)C1CSCN1.
What is the InChIKey of N-(oxolan-2-ylmethyl)-1,3-thiazolidine-4-carboxamide?
The InChIKey is KHIARCRYNJZXAG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16N2O2S/c12-9(8-5-14-6-11-8)10-4-7-2-1-3-13-7/h7-8,11H,1-6H2,(H,10,12).
What are the key properties of N-(oxolan-2-ylmethyl)-1,3-thiazolidine-4-carboxamide?
N-(oxolan-2-ylmethyl)-1,3-thiazolidine-4-carboxamide has a molecular weight of 216.31 g/mol, XLogP of -0.06, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(oxolan-2-ylmethyl)-1,3-thiazolidine-4-carboxamide is sourced from PubChem (CID 24692901), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).