C11H17NO2 — CID 24692949
3-(furan-2-ylmethoxymethyl)piperidine (PubChem CID 24692949) has the molecular formula C11H17NO2 and a molecular weight of 195.26 g/mol. Its IUPAC name is 3-(furan-2-ylmethoxymethyl)piperidine.
| Compound Name | 3-(furan-2-ylmethoxymethyl)piperidine |
|---|---|
| PubChem CID | 24692949 |
| Molecular Formula | C11H17NO2 |
| Molecular Weight | 195.26 g/mol |
| Exact Mass | 195.13 |
| IUPAC Name | 3-(furan-2-ylmethoxymethyl)piperidine |
| SMILES | c1coc(COCC2CCCNC2)c1 |
| InChI | InChI=1S/C11H17NO2/c1-3-10(7-12-5-1)8-13-9-11-4-2-6-14-11/h2,4,6,10,12H,1,3,5,7-9H2 |
| InChIKey | FBORUFYUTVAARZ-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 34.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.26 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |