About 1-(4-chlorophenyl)-2,2,2-trifluoroethanamine
1-(4-chlorophenyl)-2,2,2-trifluoroethanamine (PubChem CID 24693275) has the molecular formula C8H7ClF3N
and a molecular weight of 209.60 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-2,2,2-trifluoroethanamine.
Molecular Properties
| Compound Name | 1-(4-chlorophenyl)-2,2,2-trifluoroethanamine |
| PubChem CID | 24693275 |
| Molecular Formula | C8H7ClF3N |
| Molecular Weight | 209.60 g/mol |
| Exact Mass | 209.02 |
| IUPAC Name | 1-(4-chlorophenyl)-2,2,2-trifluoroethanamine |
| SMILES | NC(c1ccc(Cl)cc1)C(F)(F)F |
| InChI | InChI=1S/C8H7ClF3N/c9-6-3-1-5(2-4-6)7(13)8(10,11)12/h1-4,7H,13H2 |
| InChIKey | ZGFGADXCVWZZHD-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.60 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-(4-chlorophenyl)-2,2,2-trifluoroethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-chlorophenyl)-2,2,2-trifluoroethanamine?
The IUPAC name of 1-(4-chlorophenyl)-2,2,2-trifluoroethanamine (CID 24693275) is 1-(4-chlorophenyl)-2,2,2-trifluoroethanamine.
What is the SMILES notation for 1-(4-chlorophenyl)-2,2,2-trifluoroethanamine?
The canonical SMILES for 1-(4-chlorophenyl)-2,2,2-trifluoroethanamine is NC(c1ccc(Cl)cc1)C(F)(F)F.
What is the InChIKey of 1-(4-chlorophenyl)-2,2,2-trifluoroethanamine?
The InChIKey is ZGFGADXCVWZZHD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7ClF3N/c9-6-3-1-5(2-4-6)7(13)8(10,11)12/h1-4,7H,13H2.
What are the key properties of 1-(4-chlorophenyl)-2,2,2-trifluoroethanamine?
1-(4-chlorophenyl)-2,2,2-trifluoroethanamine has a molecular weight of 209.60 g/mol, XLogP of 2.90, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-chlorophenyl)-2,2,2-trifluoroethanamine is sourced from PubChem (CID 24693275), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).