C16H19N5O — CID 24693412
N'-hydroxy-2-(4-phenylpiperazin-1-yl)pyridine-3-carboximidamide (PubChem CID 24693412) has the molecular formula C16H19N5O and a molecular weight of 297.36 g/mol. Its IUPAC name is N'-hydroxy-2-(4-phenylpiperazin-1-yl)pyridine-3-carboximidamide.
| Compound Name | N'-hydroxy-2-(4-phenylpiperazin-1-yl)pyridine-3-carboximidamide |
|---|---|
| PubChem CID | 24693412 |
| Molecular Formula | C16H19N5O |
| Molecular Weight | 297.36 g/mol |
| Exact Mass | 297.16 |
| IUPAC Name | N'-hydroxy-2-(4-phenylpiperazin-1-yl)pyridine-3-carboximidamide |
| SMILES | N/C(=N\O)c1cccnc1N1CCN(c2ccccc2)CC1 |
| InChI | InChI=1S/C16H19N5O/c17-15(19-22)14-7-4-8-18-16(14)21-11-9-20(10-12-21)13-5-2-1-3-6-13/h1-8,22H,9-12H2,(H2,17,19) |
| InChIKey | YIMHTPJKSBCCPN-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 77.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.36 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|