About 1-(2,3-dihydro-1-benzofuran-2-carbonylamino)cyclohexane-1-carboxylic acid
1-(2,3-dihydro-1-benzofuran-2-carbonylamino)cyclohexane-1-carboxylic acid (PubChem CID 24693535) has the molecular formula C16H19NO4
and a molecular weight of 289.33 g/mol. Its IUPAC name is 1-(2,3-dihydro-1-benzofuran-2-carbonylamino)cyclohexane-1-carboxylic acid.
Molecular Properties
| Compound Name | 1-(2,3-dihydro-1-benzofuran-2-carbonylamino)cyclohexane-1-carboxylic acid |
| PubChem CID | 24693535 |
| Molecular Formula | C16H19NO4 |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.13 |
| IUPAC Name | 1-(2,3-dihydro-1-benzofuran-2-carbonylamino)cyclohexane-1-carboxylic acid |
| SMILES | O=C(NC1(C(=O)O)CCCCC1)C1Cc2ccccc2O1 |
| InChI | InChI=1S/C16H19NO4/c18-14(13-10-11-6-2-3-7-12(11)21-13)17-16(15(19)20)8-4-1-5-9-16/h2-3,6-7,13H,1,4-5,8-10H2,(H,17,18)(H,19,20) |
| InChIKey | OSBNNZIHOVPIAA-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(2,3-dihydro-1-benzofuran-2-carbonylamino)cyclohexane-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,3-dihydro-1-benzofuran-2-carbonylamino)cyclohexane-1-carboxylic acid?
The IUPAC name of 1-(2,3-dihydro-1-benzofuran-2-carbonylamino)cyclohexane-1-carboxylic acid (CID 24693535) is 1-(2,3-dihydro-1-benzofuran-2-carbonylamino)cyclohexane-1-carboxylic acid.
What is the SMILES notation for 1-(2,3-dihydro-1-benzofuran-2-carbonylamino)cyclohexane-1-carboxylic acid?
The canonical SMILES for 1-(2,3-dihydro-1-benzofuran-2-carbonylamino)cyclohexane-1-carboxylic acid is O=C(NC1(C(=O)O)CCCCC1)C1Cc2ccccc2O1.
What is the InChIKey of 1-(2,3-dihydro-1-benzofuran-2-carbonylamino)cyclohexane-1-carboxylic acid?
The InChIKey is OSBNNZIHOVPIAA-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19NO4/c18-14(13-10-11-6-2-3-7-12(11)21-13)17-16(15(19)20)8-4-1-5-9-16/h2-3,6-7,13H,1,4-5,8-10H2,(H,17,18)(H,19,20).
What are the key properties of 1-(2,3-dihydro-1-benzofuran-2-carbonylamino)cyclohexane-1-carboxylic acid?
1-(2,3-dihydro-1-benzofuran-2-carbonylamino)cyclohexane-1-carboxylic acid has a molecular weight of 289.33 g/mol, XLogP of 1.89, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,3-dihydro-1-benzofuran-2-carbonylamino)cyclohexane-1-carboxylic acid is sourced from PubChem (CID 24693535), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).