C13H18N2O5 — CID 24693793
7-[(2-hydroxy-6-oxo-1H-pyridine-4-carbonyl)amino]heptanoic acid (PubChem CID 24693793) has the molecular formula C13H18N2O5 and a molecular weight of 282.30 g/mol. Its IUPAC name is 7-[(2-hydroxy-6-oxo-1H-pyridine-4-carbonyl)amino]heptanoic acid.
| Compound Name | 7-[(2-hydroxy-6-oxo-1H-pyridine-4-carbonyl)amino]heptanoic acid |
|---|---|
| PubChem CID | 24693793 |
| Molecular Formula | C13H18N2O5 |
| Molecular Weight | 282.30 g/mol |
| Exact Mass | 282.12 |
| IUPAC Name | 7-[(2-hydroxy-6-oxo-1H-pyridine-4-carbonyl)amino]heptanoic acid |
| SMILES | O=C(O)CCCCCCNC(=O)c1cc(O)[nH]c(=O)c1 |
| InChI | InChI=1S/C13H18N2O5/c16-10-7-9(8-11(17)15-10)13(20)14-6-4-2-1-3-5-12(18)19/h7-8H,1-6H2,(H,14,20)(H,18,19)(H2,15,16,17) |
| InChIKey | ZCIQTFJYIQBQSF-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 119.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.30 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|