About 1-(2-hydroxyethyl)-3,5-dimethylpyrazole-4-carbaldehyde
1-(2-hydroxyethyl)-3,5-dimethylpyrazole-4-carbaldehyde (PubChem CID 24693890) has the molecular formula C8H12N2O2
and a molecular weight of 168.20 g/mol. Its IUPAC name is 1-(2-hydroxyethyl)-3,5-dimethylpyrazole-4-carbaldehyde.
Molecular Properties
| Compound Name | 1-(2-hydroxyethyl)-3,5-dimethylpyrazole-4-carbaldehyde |
| PubChem CID | 24693890 |
| Molecular Formula | C8H12N2O2 |
| Molecular Weight | 168.20 g/mol |
| Exact Mass | 168.09 |
| IUPAC Name | 1-(2-hydroxyethyl)-3,5-dimethylpyrazole-4-carbaldehyde |
| SMILES | Cc1nn(CCO)c(C)c1C=O |
| InChI | InChI=1S/C8H12N2O2/c1-6-8(5-12)7(2)10(9-6)3-4-11/h5,11H,3-4H2,1-2H3 |
| InChIKey | SRKILWHHZYRBAS-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.20 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 1-(2-hydroxyethyl)-3,5-dimethylpyrazole-4-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-hydroxyethyl)-3,5-dimethylpyrazole-4-carbaldehyde?
The IUPAC name of 1-(2-hydroxyethyl)-3,5-dimethylpyrazole-4-carbaldehyde (CID 24693890) is 1-(2-hydroxyethyl)-3,5-dimethylpyrazole-4-carbaldehyde.
What is the SMILES notation for 1-(2-hydroxyethyl)-3,5-dimethylpyrazole-4-carbaldehyde?
The canonical SMILES for 1-(2-hydroxyethyl)-3,5-dimethylpyrazole-4-carbaldehyde is Cc1nn(CCO)c(C)c1C=O.
What is the InChIKey of 1-(2-hydroxyethyl)-3,5-dimethylpyrazole-4-carbaldehyde?
The InChIKey is SRKILWHHZYRBAS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N2O2/c1-6-8(5-12)7(2)10(9-6)3-4-11/h5,11H,3-4H2,1-2H3.
What are the key properties of 1-(2-hydroxyethyl)-3,5-dimethylpyrazole-4-carbaldehyde?
1-(2-hydroxyethyl)-3,5-dimethylpyrazole-4-carbaldehyde has a molecular weight of 168.20 g/mol, XLogP of 0.30, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-hydroxyethyl)-3,5-dimethylpyrazole-4-carbaldehyde is sourced from PubChem (CID 24693890), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).