C11H15NO2 — CID 24695518
2-amino-2-(2,5-dimethylphenyl)propanoic acid (PubChem CID 24695518) has the molecular formula C11H15NO2 and a molecular weight of 193.25 g/mol. Its IUPAC name is 2-amino-2-(2,5-dimethylphenyl)propanoic acid.
| Compound Name | 2-amino-2-(2,5-dimethylphenyl)propanoic acid |
|---|---|
| PubChem CID | 24695518 |
| Molecular Formula | C11H15NO2 |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.11 |
| IUPAC Name | 2-amino-2-(2,5-dimethylphenyl)propanoic acid |
| SMILES | Cc1ccc(C)c(C(C)(N)C(=O)O)c1 |
| InChI | InChI=1S/C11H15NO2/c1-7-4-5-8(2)9(6-7)11(3,12)10(13)14/h4-6H,12H2,1-3H3,(H,13,14) |
| InChIKey | ZFSYRISYXZWCRA-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |