C12H13NO2 — CID 24695847
(NE)-N-[1-(2-prop-2-ynoxyphenyl)propylidene]hydroxylamine (PubChem CID 24695847) has the molecular formula C12H13NO2 and a molecular weight of 203.24 g/mol. Its IUPAC name is (NE)-N-[1-(2-prop-2-ynoxyphenyl)propylidene]hydroxylamine.
| Compound Name | (NE)-N-[1-(2-prop-2-ynoxyphenyl)propylidene]hydroxylamine |
|---|---|
| PubChem CID | 24695847 |
| Molecular Formula | C12H13NO2 |
| Molecular Weight | 203.24 g/mol |
| Exact Mass | 203.09 |
| IUPAC Name | (NE)-N-[1-(2-prop-2-ynoxyphenyl)propylidene]hydroxylamine |
| SMILES | C#CCOc1ccccc1/C(CC)=N/O |
| InChI | InChI=1S/C12H13NO2/c1-3-9-15-12-8-6-5-7-10(12)11(4-2)13-14/h1,5-8,14H,4,9H2,2H3/b13-11+ |
| InChIKey | LAZPKNXOYPZZDZ-ACCUITESSA-N |
| XLogP | 2.29 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.24 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|