About 2-(1,2,4-triazol-1-yl)pyridine-3-carbothioamide
2-(1,2,4-triazol-1-yl)pyridine-3-carbothioamide (PubChem CID 24696176) has the molecular formula C8H7N5S
and a molecular weight of 205.25 g/mol. Its IUPAC name is 2-(1,2,4-triazol-1-yl)pyridine-3-carbothioamide.
Molecular Properties
| Compound Name | 2-(1,2,4-triazol-1-yl)pyridine-3-carbothioamide |
| PubChem CID | 24696176 |
| Molecular Formula | C8H7N5S |
| Molecular Weight | 205.25 g/mol |
| Exact Mass | 205.04 |
| IUPAC Name | 2-(1,2,4-triazol-1-yl)pyridine-3-carbothioamide |
| SMILES | NC(=S)c1cccnc1-n1cncn1 |
| InChI | InChI=1S/C8H7N5S/c9-7(14)6-2-1-3-11-8(6)13-5-10-4-12-13/h1-5H,(H2,9,14) |
| InChIKey | IKKXFGBQJOUNAS-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.25 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 2-(1,2,4-triazol-1-yl)pyridine-3-carbothioamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,2,4-triazol-1-yl)pyridine-3-carbothioamide?
The IUPAC name of 2-(1,2,4-triazol-1-yl)pyridine-3-carbothioamide (CID 24696176) is 2-(1,2,4-triazol-1-yl)pyridine-3-carbothioamide.
What is the SMILES notation for 2-(1,2,4-triazol-1-yl)pyridine-3-carbothioamide?
The canonical SMILES for 2-(1,2,4-triazol-1-yl)pyridine-3-carbothioamide is NC(=S)c1cccnc1-n1cncn1.
What is the InChIKey of 2-(1,2,4-triazol-1-yl)pyridine-3-carbothioamide?
The InChIKey is IKKXFGBQJOUNAS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7N5S/c9-7(14)6-2-1-3-11-8(6)13-5-10-4-12-13/h1-5H,(H2,9,14).
What are the key properties of 2-(1,2,4-triazol-1-yl)pyridine-3-carbothioamide?
2-(1,2,4-triazol-1-yl)pyridine-3-carbothioamide has a molecular weight of 205.25 g/mol, XLogP of 0.30, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,2,4-triazol-1-yl)pyridine-3-carbothioamide is sourced from PubChem (CID 24696176), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).