About 2-piperidin-3-yl-1,2-thiazolidine 1,1-dioxide
2-piperidin-3-yl-1,2-thiazolidine 1,1-dioxide (PubChem CID 24696214) has the molecular formula C8H16N2O2S
and a molecular weight of 204.29 g/mol. Its IUPAC name is 2-piperidin-3-yl-1,2-thiazolidine 1,1-dioxide.
Molecular Properties
| Compound Name | 2-piperidin-3-yl-1,2-thiazolidine 1,1-dioxide |
| PubChem CID | 24696214 |
| Molecular Formula | C8H16N2O2S |
| Molecular Weight | 204.29 g/mol |
| Exact Mass | 204.09 |
| IUPAC Name | 2-piperidin-3-yl-1,2-thiazolidine 1,1-dioxide |
| SMILES | O=S1(=O)CCCN1C1CCCNC1 |
| InChI | InChI=1S/C8H16N2O2S/c11-13(12)6-2-5-10(13)8-3-1-4-9-7-8/h8-9H,1-7H2 |
| InChIKey | QYYIFPAGOZABRS-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.29 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-piperidin-3-yl-1,2-thiazolidine 1,1-dioxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-piperidin-3-yl-1,2-thiazolidine 1,1-dioxide?
The IUPAC name of 2-piperidin-3-yl-1,2-thiazolidine 1,1-dioxide (CID 24696214) is 2-piperidin-3-yl-1,2-thiazolidine 1,1-dioxide.
What is the SMILES notation for 2-piperidin-3-yl-1,2-thiazolidine 1,1-dioxide?
The canonical SMILES for 2-piperidin-3-yl-1,2-thiazolidine 1,1-dioxide is O=S1(=O)CCCN1C1CCCNC1.
What is the InChIKey of 2-piperidin-3-yl-1,2-thiazolidine 1,1-dioxide?
The InChIKey is QYYIFPAGOZABRS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16N2O2S/c11-13(12)6-2-5-10(13)8-3-1-4-9-7-8/h8-9H,1-7H2.
What are the key properties of 2-piperidin-3-yl-1,2-thiazolidine 1,1-dioxide?
2-piperidin-3-yl-1,2-thiazolidine 1,1-dioxide has a molecular weight of 204.29 g/mol, XLogP of -0.23, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-piperidin-3-yl-1,2-thiazolidine 1,1-dioxide is sourced from PubChem (CID 24696214), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).