C11H22N2O — CID 24696467
1-amino-N,N-diethylcyclohexane-1-carboxamide (PubChem CID 24696467) has the molecular formula C11H22N2O and a molecular weight of 198.31 g/mol. Its IUPAC name is 1-amino-N,N-diethylcyclohexane-1-carboxamide.
| Compound Name | 1-amino-N,N-diethylcyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 24696467 |
| Molecular Formula | C11H22N2O |
| Molecular Weight | 198.31 g/mol |
| Exact Mass | 198.17 |
| IUPAC Name | 1-amino-N,N-diethylcyclohexane-1-carboxamide |
| SMILES | CCN(CC)C(=O)C1(N)CCCCC1 |
| InChI | InChI=1S/C11H22N2O/c1-3-13(4-2)10(14)11(12)8-6-5-7-9-11/h3-9,12H2,1-2H3 |
| InChIKey | LTIKAHOLVVSRIT-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.31 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |