About 4-chloro-2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)aniline
4-chloro-2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)aniline (PubChem CID 24697491) has the molecular formula C12H9ClN4
and a molecular weight of 244.69 g/mol. Its IUPAC name is 4-chloro-2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)aniline.
Molecular Properties
| Compound Name | 4-chloro-2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)aniline |
| PubChem CID | 24697491 |
| Molecular Formula | C12H9ClN4 |
| Molecular Weight | 244.69 g/mol |
| Exact Mass | 244.05 |
| IUPAC Name | 4-chloro-2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)aniline |
| SMILES | Nc1ccc(Cl)cc1-c1nnc2ccccn12 |
| InChI | InChI=1S/C12H9ClN4/c13-8-4-5-10(14)9(7-8)12-16-15-11-3-1-2-6-17(11)12/h1-7H,14H2 |
| InChIKey | UGJHUHUUGWFXRT-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 56.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.69 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-chloro-2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)aniline?
The IUPAC name of 4-chloro-2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)aniline (CID 24697491) is 4-chloro-2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)aniline.
What is the SMILES notation for 4-chloro-2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)aniline?
The canonical SMILES for 4-chloro-2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)aniline is Nc1ccc(Cl)cc1-c1nnc2ccccn12.
What is the InChIKey of 4-chloro-2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)aniline?
The InChIKey is UGJHUHUUGWFXRT-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9ClN4/c13-8-4-5-10(14)9(7-8)12-16-15-11-3-1-2-6-17(11)12/h1-7H,14H2.
What are the key properties of 4-chloro-2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)aniline?
4-chloro-2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)aniline has a molecular weight of 244.69 g/mol, XLogP of 2.63, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)aniline is sourced from PubChem (CID 24697491), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).