About 4-methoxybutanimidamide
4-methoxybutanimidamide (PubChem CID 24698705) has the molecular formula C5H12N2O
and a molecular weight of 116.16 g/mol. Its IUPAC name is 4-methoxybutanimidamide.
Molecular Properties
| Compound Name | 4-methoxybutanimidamide |
| PubChem CID | 24698705 |
| Molecular Formula | C5H12N2O |
| Molecular Weight | 116.16 g/mol |
| Exact Mass | 116.09 |
| IUPAC Name | 4-methoxybutanimidamide |
| SMILES | [H]/N=C(/N)CCCOC |
| InChI | InChI=1S/C5H12N2O/c1-8-4-2-3-5(6)7/h2-4H2,1H3,(H3,6,7) |
| InChIKey | PORUULVZUHMYKC-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 59.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 116.16 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 4-methoxybutanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methoxybutanimidamide?
The IUPAC name of 4-methoxybutanimidamide (CID 24698705) is 4-methoxybutanimidamide.
What is the SMILES notation for 4-methoxybutanimidamide?
The canonical SMILES for 4-methoxybutanimidamide is [H]/N=C(/N)CCCOC.
What is the InChIKey of 4-methoxybutanimidamide?
The InChIKey is PORUULVZUHMYKC-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H12N2O/c1-8-4-2-3-5(6)7/h2-4H2,1H3,(H3,6,7).
What are the key properties of 4-methoxybutanimidamide?
4-methoxybutanimidamide has a molecular weight of 116.16 g/mol, XLogP of 0.35, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methoxybutanimidamide is sourced from PubChem (CID 24698705), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).