C14H18N2OS — CID 24698917
3-(4-methylpiperidine-1-carbonyl)benzenecarbothioamide (PubChem CID 24698917) has the molecular formula C14H18N2OS and a molecular weight of 262.38 g/mol. Its IUPAC name is 3-(4-methylpiperidine-1-carbonyl)benzenecarbothioamide.
| Compound Name | 3-(4-methylpiperidine-1-carbonyl)benzenecarbothioamide |
|---|---|
| PubChem CID | 24698917 |
| Molecular Formula | C14H18N2OS |
| Molecular Weight | 262.38 g/mol |
| Exact Mass | 262.11 |
| IUPAC Name | 3-(4-methylpiperidine-1-carbonyl)benzenecarbothioamide |
| SMILES | CC1CCN(C(=O)c2cccc(C(N)=S)c2)CC1 |
| InChI | InChI=1S/C14H18N2OS/c1-10-5-7-16(8-6-10)14(17)12-4-2-3-11(9-12)13(15)18/h2-4,9-10H,5-8H2,1H3,(H2,15,18) |
| InChIKey | MCBZMYXWJJRHEV-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.38 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|