About 2-(2,6-dimethylpiperidin-1-yl)-N'-hydroxyethanimidamide
2-(2,6-dimethylpiperidin-1-yl)-N'-hydroxyethanimidamide (PubChem CID 24699314) has the molecular formula C9H19N3O
and a molecular weight of 185.27 g/mol. Its IUPAC name is 2-(2,6-dimethylpiperidin-1-yl)-N'-hydroxyethanimidamide.
Molecular Properties
| Compound Name | 2-(2,6-dimethylpiperidin-1-yl)-N'-hydroxyethanimidamide |
| PubChem CID | 24699314 |
| Molecular Formula | C9H19N3O |
| Molecular Weight | 185.27 g/mol |
| Exact Mass | 185.15 |
| IUPAC Name | 2-(2,6-dimethylpiperidin-1-yl)-N'-hydroxyethanimidamide |
| SMILES | CC1CCCC(C)N1C/C(N)=N/O |
| InChI | InChI=1S/C9H19N3O/c1-7-4-3-5-8(2)12(7)6-9(10)11-13/h7-8,13H,3-6H2,1-2H3,(H2,10,11) |
| InChIKey | JPLUGANOTRHSBE-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 61.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.27 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(2,6-dimethylpiperidin-1-yl)-N'-hydroxyethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,6-dimethylpiperidin-1-yl)-N'-hydroxyethanimidamide?
The IUPAC name of 2-(2,6-dimethylpiperidin-1-yl)-N'-hydroxyethanimidamide (CID 24699314) is 2-(2,6-dimethylpiperidin-1-yl)-N'-hydroxyethanimidamide.
What is the SMILES notation for 2-(2,6-dimethylpiperidin-1-yl)-N'-hydroxyethanimidamide?
The canonical SMILES for 2-(2,6-dimethylpiperidin-1-yl)-N'-hydroxyethanimidamide is CC1CCCC(C)N1C/C(N)=N/O.
What is the InChIKey of 2-(2,6-dimethylpiperidin-1-yl)-N'-hydroxyethanimidamide?
The InChIKey is JPLUGANOTRHSBE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H19N3O/c1-7-4-3-5-8(2)12(7)6-9(10)11-13/h7-8,13H,3-6H2,1-2H3,(H2,10,11).
What are the key properties of 2-(2,6-dimethylpiperidin-1-yl)-N'-hydroxyethanimidamide?
2-(2,6-dimethylpiperidin-1-yl)-N'-hydroxyethanimidamide has a molecular weight of 185.27 g/mol, XLogP of 1.00, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,6-dimethylpiperidin-1-yl)-N'-hydroxyethanimidamide is sourced from PubChem (CID 24699314), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).