About 3-[(4-ethyl-2,3-dioxopiperazin-1-yl)methyl]benzonitrile
3-[(4-ethyl-2,3-dioxopiperazin-1-yl)methyl]benzonitrile (PubChem CID 24699758) has the molecular formula C14H15N3O2
and a molecular weight of 257.29 g/mol. Its IUPAC name is 3-[(4-ethyl-2,3-dioxopiperazin-1-yl)methyl]benzonitrile.
Molecular Properties
| Compound Name | 3-[(4-ethyl-2,3-dioxopiperazin-1-yl)methyl]benzonitrile |
| PubChem CID | 24699758 |
| Molecular Formula | C14H15N3O2 |
| Molecular Weight | 257.29 g/mol |
| Exact Mass | 257.12 |
| IUPAC Name | 3-[(4-ethyl-2,3-dioxopiperazin-1-yl)methyl]benzonitrile |
| SMILES | CCN1CCN(Cc2cccc(C#N)c2)C(=O)C1=O |
| InChI | InChI=1S/C14H15N3O2/c1-2-16-6-7-17(14(19)13(16)18)10-12-5-3-4-11(8-12)9-15/h3-5,8H,2,6-7,10H2,1H3 |
| InChIKey | JMSBWXRSJYJONR-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 64.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.29 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 3-[(4-ethyl-2,3-dioxopiperazin-1-yl)methyl]benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(4-ethyl-2,3-dioxopiperazin-1-yl)methyl]benzonitrile?
The IUPAC name of 3-[(4-ethyl-2,3-dioxopiperazin-1-yl)methyl]benzonitrile (CID 24699758) is 3-[(4-ethyl-2,3-dioxopiperazin-1-yl)methyl]benzonitrile.
What is the SMILES notation for 3-[(4-ethyl-2,3-dioxopiperazin-1-yl)methyl]benzonitrile?
The canonical SMILES for 3-[(4-ethyl-2,3-dioxopiperazin-1-yl)methyl]benzonitrile is CCN1CCN(Cc2cccc(C#N)c2)C(=O)C1=O.
What is the InChIKey of 3-[(4-ethyl-2,3-dioxopiperazin-1-yl)methyl]benzonitrile?
The InChIKey is JMSBWXRSJYJONR-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15N3O2/c1-2-16-6-7-17(14(19)13(16)18)10-12-5-3-4-11(8-12)9-15/h3-5,8H,2,6-7,10H2,1H3.
What are the key properties of 3-[(4-ethyl-2,3-dioxopiperazin-1-yl)methyl]benzonitrile?
3-[(4-ethyl-2,3-dioxopiperazin-1-yl)methyl]benzonitrile has a molecular weight of 257.29 g/mol, XLogP of 0.75, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(4-ethyl-2,3-dioxopiperazin-1-yl)methyl]benzonitrile is sourced from PubChem (CID 24699758), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).