C10H11NO4 — CID 2469983
(2-amino-2-oxoethyl) 2-hydroxy-4-methylbenzoate (PubChem CID 2469983) has the molecular formula C10H11NO4 and a molecular weight of 209.20 g/mol. Its IUPAC name is (2-amino-2-oxoethyl) 2-hydroxy-4-methylbenzoate.
| Compound Name | (2-amino-2-oxoethyl) 2-hydroxy-4-methylbenzoate |
|---|---|
| PubChem CID | 2469983 |
| Molecular Formula | C10H11NO4 |
| Molecular Weight | 209.20 g/mol |
| Exact Mass | 209.07 |
| IUPAC Name | (2-amino-2-oxoethyl) 2-hydroxy-4-methylbenzoate |
| SMILES | Cc1ccc(C(=O)OCC(N)=O)c(O)c1 |
| InChI | InChI=1S/C10H11NO4/c1-6-2-3-7(8(12)4-6)10(14)15-5-9(11)13/h2-4,12H,5H2,1H3,(H2,11,13) |
| InChIKey | GSQJKQBTMINGMR-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 89.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.20 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |