About (4-hydroxyiminopiperidin-1-yl)-(5-methyl-1,2-oxazol-4-yl)methanone
(4-hydroxyiminopiperidin-1-yl)-(5-methyl-1,2-oxazol-4-yl)methanone (PubChem CID 24702028) has the molecular formula C10H13N3O3
and a molecular weight of 223.23 g/mol. Its IUPAC name is (4-hydroxyiminopiperidin-1-yl)-(5-methyl-1,2-oxazol-4-yl)methanone.
Molecular Properties
| Compound Name | (4-hydroxyiminopiperidin-1-yl)-(5-methyl-1,2-oxazol-4-yl)methanone |
| PubChem CID | 24702028 |
| Molecular Formula | C10H13N3O3 |
| Molecular Weight | 223.23 g/mol |
| Exact Mass | 223.10 |
| IUPAC Name | (4-hydroxyiminopiperidin-1-yl)-(5-methyl-1,2-oxazol-4-yl)methanone |
| SMILES | Cc1oncc1C(=O)N1CCC(=NO)CC1 |
| InChI | InChI=1S/C10H13N3O3/c1-7-9(6-11-16-7)10(14)13-4-2-8(12-15)3-5-13/h6,15H,2-5H2,1H3 |
| InChIKey | OSIUCQPZZRLXHX-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 78.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.23 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (4-hydroxyiminopiperidin-1-yl)-(5-methyl-1,2-oxazol-4-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-hydroxyiminopiperidin-1-yl)-(5-methyl-1,2-oxazol-4-yl)methanone?
The IUPAC name of (4-hydroxyiminopiperidin-1-yl)-(5-methyl-1,2-oxazol-4-yl)methanone (CID 24702028) is (4-hydroxyiminopiperidin-1-yl)-(5-methyl-1,2-oxazol-4-yl)methanone.
What is the SMILES notation for (4-hydroxyiminopiperidin-1-yl)-(5-methyl-1,2-oxazol-4-yl)methanone?
The canonical SMILES for (4-hydroxyiminopiperidin-1-yl)-(5-methyl-1,2-oxazol-4-yl)methanone is Cc1oncc1C(=O)N1CCC(=NO)CC1.
What is the InChIKey of (4-hydroxyiminopiperidin-1-yl)-(5-methyl-1,2-oxazol-4-yl)methanone?
The InChIKey is OSIUCQPZZRLXHX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13N3O3/c1-7-9(6-11-16-7)10(14)13-4-2-8(12-15)3-5-13/h6,15H,2-5H2,1H3.
What are the key properties of (4-hydroxyiminopiperidin-1-yl)-(5-methyl-1,2-oxazol-4-yl)methanone?
(4-hydroxyiminopiperidin-1-yl)-(5-methyl-1,2-oxazol-4-yl)methanone has a molecular weight of 223.23 g/mol, XLogP of 1.05, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (4-hydroxyiminopiperidin-1-yl)-(5-methyl-1,2-oxazol-4-yl)methanone is sourced from PubChem (CID 24702028), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).