About 4-methoxybutanethioamide
4-methoxybutanethioamide (PubChem CID 24702091) has the molecular formula C5H11NOS
and a molecular weight of 133.22 g/mol. Its IUPAC name is 4-methoxybutanethioamide.
Molecular Properties
| Compound Name | 4-methoxybutanethioamide |
| PubChem CID | 24702091 |
| Molecular Formula | C5H11NOS |
| Molecular Weight | 133.22 g/mol |
| Exact Mass | 133.06 |
| IUPAC Name | 4-methoxybutanethioamide |
| SMILES | COCCCC(N)=S |
| InChI | InChI=1S/C5H11NOS/c1-7-4-2-3-5(6)8/h2-4H2,1H3,(H2,6,8) |
| InChIKey | QKKIPHYCDHJMAF-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 133.22 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 4-methoxybutanethioamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methoxybutanethioamide?
The IUPAC name of 4-methoxybutanethioamide (CID 24702091) is 4-methoxybutanethioamide.
What is the SMILES notation for 4-methoxybutanethioamide?
The canonical SMILES for 4-methoxybutanethioamide is COCCCC(N)=S.
What is the InChIKey of 4-methoxybutanethioamide?
The InChIKey is QKKIPHYCDHJMAF-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H11NOS/c1-7-4-2-3-5(6)8/h2-4H2,1H3,(H2,6,8).
What are the key properties of 4-methoxybutanethioamide?
4-methoxybutanethioamide has a molecular weight of 133.22 g/mol, XLogP of 0.70, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methoxybutanethioamide is sourced from PubChem (CID 24702091), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).