About N-[4-[2-(4,5-dichloro-6-oxopyridazin-1-yl)acetyl]phenyl]propanamide
N-[4-[2-(4,5-dichloro-6-oxopyridazin-1-yl)acetyl]phenyl]propanamide (PubChem CID 2470212) has the molecular formula C15H13Cl2N3O3
and a molecular weight of 354.19 g/mol. Its IUPAC name is N-[4-[2-(4,5-dichloro-6-oxopyridazin-1-yl)acetyl]phenyl]propanamide.
Molecular Properties
| Compound Name | N-[4-[2-(4,5-dichloro-6-oxopyridazin-1-yl)acetyl]phenyl]propanamide |
| PubChem CID | 2470212 |
| Molecular Formula | C15H13Cl2N3O3 |
| Molecular Weight | 354.19 g/mol |
| Exact Mass | 353.03 |
| IUPAC Name | N-[4-[2-(4,5-dichloro-6-oxopyridazin-1-yl)acetyl]phenyl]propanamide |
| SMILES | CCC(=O)Nc1ccc(C(=O)Cn2ncc(Cl)c(Cl)c2=O)cc1 |
| InChI | InChI=1S/C15H13Cl2N3O3/c1-2-13(22)19-10-5-3-9(4-6-10)12(21)8-20-15(23)14(17)11(16)7-18-20/h3-7H,2,8H2,1H3,(H,19,22) |
| InChIKey | YWCFGOMDCLQCBM-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 81.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.19 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[4-[2-(4,5-dichloro-6-oxopyridazin-1-yl)acetyl]phenyl]propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-[2-(4,5-dichloro-6-oxopyridazin-1-yl)acetyl]phenyl]propanamide?
The IUPAC name of N-[4-[2-(4,5-dichloro-6-oxopyridazin-1-yl)acetyl]phenyl]propanamide (CID 2470212) is N-[4-[2-(4,5-dichloro-6-oxopyridazin-1-yl)acetyl]phenyl]propanamide.
What is the SMILES notation for N-[4-[2-(4,5-dichloro-6-oxopyridazin-1-yl)acetyl]phenyl]propanamide?
The canonical SMILES for N-[4-[2-(4,5-dichloro-6-oxopyridazin-1-yl)acetyl]phenyl]propanamide is CCC(=O)Nc1ccc(C(=O)Cn2ncc(Cl)c(Cl)c2=O)cc1.
What is the InChIKey of N-[4-[2-(4,5-dichloro-6-oxopyridazin-1-yl)acetyl]phenyl]propanamide?
The InChIKey is YWCFGOMDCLQCBM-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13Cl2N3O3/c1-2-13(22)19-10-5-3-9(4-6-10)12(21)8-20-15(23)14(17)11(16)7-18-20/h3-7H,2,8H2,1H3,(H,19,22).
What are the key properties of N-[4-[2-(4,5-dichloro-6-oxopyridazin-1-yl)acetyl]phenyl]propanamide?
N-[4-[2-(4,5-dichloro-6-oxopyridazin-1-yl)acetyl]phenyl]propanamide has a molecular weight of 354.19 g/mol, XLogP of 2.78, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-[2-(4,5-dichloro-6-oxopyridazin-1-yl)acetyl]phenyl]propanamide is sourced from PubChem (CID 2470212), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).