About 2-(2-methylthieno[2,3-e][1,3]benzothiazol-5-yl)oxyethanamine
2-(2-methylthieno[2,3-e][1,3]benzothiazol-5-yl)oxyethanamine (PubChem CID 24702680) has the molecular formula C12H12N2OS2
and a molecular weight of 264.38 g/mol. Its IUPAC name is 2-(2-methylthieno[2,3-e][1,3]benzothiazol-5-yl)oxyethanamine.
Molecular Properties
| Compound Name | 2-(2-methylthieno[2,3-e][1,3]benzothiazol-5-yl)oxyethanamine |
| PubChem CID | 24702680 |
| Molecular Formula | C12H12N2OS2 |
| Molecular Weight | 264.38 g/mol |
| Exact Mass | 264.04 |
| IUPAC Name | 2-(2-methylthieno[2,3-e][1,3]benzothiazol-5-yl)oxyethanamine |
| SMILES | Cc1nc2c(cc(OCCN)c3ccsc32)s1 |
| InChI | InChI=1S/C12H12N2OS2/c1-7-14-11-10(17-7)6-9(15-4-3-13)8-2-5-16-12(8)11/h2,5-6H,3-4,13H2,1H3 |
| InChIKey | BAGIVGWNCITZHB-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.38 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(2-methylthieno[2,3-e][1,3]benzothiazol-5-yl)oxyethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-methylthieno[2,3-e][1,3]benzothiazol-5-yl)oxyethanamine?
The IUPAC name of 2-(2-methylthieno[2,3-e][1,3]benzothiazol-5-yl)oxyethanamine (CID 24702680) is 2-(2-methylthieno[2,3-e][1,3]benzothiazol-5-yl)oxyethanamine.
What is the SMILES notation for 2-(2-methylthieno[2,3-e][1,3]benzothiazol-5-yl)oxyethanamine?
The canonical SMILES for 2-(2-methylthieno[2,3-e][1,3]benzothiazol-5-yl)oxyethanamine is Cc1nc2c(cc(OCCN)c3ccsc32)s1.
What is the InChIKey of 2-(2-methylthieno[2,3-e][1,3]benzothiazol-5-yl)oxyethanamine?
The InChIKey is BAGIVGWNCITZHB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12N2OS2/c1-7-14-11-10(17-7)6-9(15-4-3-13)8-2-5-16-12(8)11/h2,5-6H,3-4,13H2,1H3.
What are the key properties of 2-(2-methylthieno[2,3-e][1,3]benzothiazol-5-yl)oxyethanamine?
2-(2-methylthieno[2,3-e][1,3]benzothiazol-5-yl)oxyethanamine has a molecular weight of 264.38 g/mol, XLogP of 3.16, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-methylthieno[2,3-e][1,3]benzothiazol-5-yl)oxyethanamine is sourced from PubChem (CID 24702680), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).