C15H14F2N2O — CID 24703610
2-amino-N-(3,5-difluorophenyl)-3-phenylpropanamide (PubChem CID 24703610) has the molecular formula C15H14F2N2O and a molecular weight of 276.29 g/mol. Its IUPAC name is 2-amino-N-(3,5-difluorophenyl)-3-phenylpropanamide.
| Compound Name | 2-amino-N-(3,5-difluorophenyl)-3-phenylpropanamide |
|---|---|
| PubChem CID | 24703610 |
| Molecular Formula | C15H14F2N2O |
| Molecular Weight | 276.29 g/mol |
| Exact Mass | 276.11 |
| IUPAC Name | 2-amino-N-(3,5-difluorophenyl)-3-phenylpropanamide |
| SMILES | NC(Cc1ccccc1)C(=O)Nc1cc(F)cc(F)c1 |
| InChI | InChI=1S/C15H14F2N2O/c16-11-7-12(17)9-13(8-11)19-15(20)14(18)6-10-4-2-1-3-5-10/h1-5,7-9,14H,6,18H2,(H,19,20) |
| InChIKey | QKMQERLLWBEGJI-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.29 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |