About (2E)-2-benzylidene-5-(1,3-dithian-2-ylidene)cyclopentan-1-one
(2E)-2-benzylidene-5-(1,3-dithian-2-ylidene)cyclopentan-1-one (PubChem CID 2470426) has the molecular formula C16H16OS2
and a molecular weight of 288.44 g/mol. Its IUPAC name is (2E)-2-benzylidene-5-(1,3-dithian-2-ylidene)cyclopentan-1-one.
Molecular Properties
| Compound Name | (2E)-2-benzylidene-5-(1,3-dithian-2-ylidene)cyclopentan-1-one |
| PubChem CID | 2470426 |
| Molecular Formula | C16H16OS2 |
| Molecular Weight | 288.44 g/mol |
| Exact Mass | 288.06 |
| IUPAC Name | (2E)-2-benzylidene-5-(1,3-dithian-2-ylidene)cyclopentan-1-one |
| SMILES | O=C1C(=C2SCCCS2)CC/C1=C\c1ccccc1 |
| InChI | InChI=1S/C16H16OS2/c17-15-13(11-12-5-2-1-3-6-12)7-8-14(15)16-18-9-4-10-19-16/h1-3,5-6,11H,4,7-10H2/b13-11+ |
| InChIKey | BNFFDBNDYBIIQW-ACCUITESSA-N |
| XLogP | 4.51 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.44 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (2E)-2-benzylidene-5-(1,3-dithian-2-ylidene)cyclopentan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E)-2-benzylidene-5-(1,3-dithian-2-ylidene)cyclopentan-1-one?
The IUPAC name of (2E)-2-benzylidene-5-(1,3-dithian-2-ylidene)cyclopentan-1-one (CID 2470426) is (2E)-2-benzylidene-5-(1,3-dithian-2-ylidene)cyclopentan-1-one.
What is the SMILES notation for (2E)-2-benzylidene-5-(1,3-dithian-2-ylidene)cyclopentan-1-one?
The canonical SMILES for (2E)-2-benzylidene-5-(1,3-dithian-2-ylidene)cyclopentan-1-one is O=C1C(=C2SCCCS2)CC/C1=C\c1ccccc1.
What is the InChIKey of (2E)-2-benzylidene-5-(1,3-dithian-2-ylidene)cyclopentan-1-one?
The InChIKey is BNFFDBNDYBIIQW-ACCUITESSA-N. The full InChI is InChI=1S/C16H16OS2/c17-15-13(11-12-5-2-1-3-6-12)7-8-14(15)16-18-9-4-10-19-16/h1-3,5-6,11H,4,7-10H2/b13-11+.
What are the key properties of (2E)-2-benzylidene-5-(1,3-dithian-2-ylidene)cyclopentan-1-one?
(2E)-2-benzylidene-5-(1,3-dithian-2-ylidene)cyclopentan-1-one has a molecular weight of 288.44 g/mol, XLogP of 4.51, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2E)-2-benzylidene-5-(1,3-dithian-2-ylidene)cyclopentan-1-one is sourced from PubChem (CID 2470426), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).