About 3-(aminomethyl)-N,N-dipropylthiolan-3-amine
3-(aminomethyl)-N,N-dipropylthiolan-3-amine (PubChem CID 24705226) has the molecular formula C11H24N2S
and a molecular weight of 216.39 g/mol. Its IUPAC name is 3-(aminomethyl)-N,N-dipropylthiolan-3-amine.
Molecular Properties
| Compound Name | 3-(aminomethyl)-N,N-dipropylthiolan-3-amine |
| PubChem CID | 24705226 |
| Molecular Formula | C11H24N2S |
| Molecular Weight | 216.39 g/mol |
| Exact Mass | 216.17 |
| IUPAC Name | 3-(aminomethyl)-N,N-dipropylthiolan-3-amine |
| SMILES | CCCN(CCC)C1(CN)CCSC1 |
| InChI | InChI=1S/C11H24N2S/c1-3-6-13(7-4-2)11(9-12)5-8-14-10-11/h3-10,12H2,1-2H3 |
| InChIKey | VOEDVBHBBPTOTM-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.39 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(aminomethyl)-N,N-dipropylthiolan-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(aminomethyl)-N,N-dipropylthiolan-3-amine?
The IUPAC name of 3-(aminomethyl)-N,N-dipropylthiolan-3-amine (CID 24705226) is 3-(aminomethyl)-N,N-dipropylthiolan-3-amine.
What is the SMILES notation for 3-(aminomethyl)-N,N-dipropylthiolan-3-amine?
The canonical SMILES for 3-(aminomethyl)-N,N-dipropylthiolan-3-amine is CCCN(CCC)C1(CN)CCSC1.
What is the InChIKey of 3-(aminomethyl)-N,N-dipropylthiolan-3-amine?
The InChIKey is VOEDVBHBBPTOTM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H24N2S/c1-3-6-13(7-4-2)11(9-12)5-8-14-10-11/h3-10,12H2,1-2H3.
What are the key properties of 3-(aminomethyl)-N,N-dipropylthiolan-3-amine?
3-(aminomethyl)-N,N-dipropylthiolan-3-amine has a molecular weight of 216.39 g/mol, XLogP of 1.94, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(aminomethyl)-N,N-dipropylthiolan-3-amine is sourced from PubChem (CID 24705226), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).