About 2-[(2-amino-4-methyl-1,3-thiazol-5-yl)sulfanyl]acetonitrile
2-[(2-amino-4-methyl-1,3-thiazol-5-yl)sulfanyl]acetonitrile (PubChem CID 24706792) has the molecular formula C6H7N3S2
and a molecular weight of 185.28 g/mol. Its IUPAC name is 2-[(2-amino-4-methyl-1,3-thiazol-5-yl)sulfanyl]acetonitrile.
Molecular Properties
| Compound Name | 2-[(2-amino-4-methyl-1,3-thiazol-5-yl)sulfanyl]acetonitrile |
| PubChem CID | 24706792 |
| Molecular Formula | C6H7N3S2 |
| Molecular Weight | 185.28 g/mol |
| Exact Mass | 185.01 |
| IUPAC Name | 2-[(2-amino-4-methyl-1,3-thiazol-5-yl)sulfanyl]acetonitrile |
| SMILES | Cc1nc(N)sc1SCC#N |
| InChI | InChI=1S/C6H7N3S2/c1-4-5(10-3-2-7)11-6(8)9-4/h3H2,1H3,(H2,8,9) |
| InChIKey | NYHFYHGWZWEWBU-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 62.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.28 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[(2-amino-4-methyl-1,3-thiazol-5-yl)sulfanyl]acetonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2-amino-4-methyl-1,3-thiazol-5-yl)sulfanyl]acetonitrile?
The IUPAC name of 2-[(2-amino-4-methyl-1,3-thiazol-5-yl)sulfanyl]acetonitrile (CID 24706792) is 2-[(2-amino-4-methyl-1,3-thiazol-5-yl)sulfanyl]acetonitrile.
What is the SMILES notation for 2-[(2-amino-4-methyl-1,3-thiazol-5-yl)sulfanyl]acetonitrile?
The canonical SMILES for 2-[(2-amino-4-methyl-1,3-thiazol-5-yl)sulfanyl]acetonitrile is Cc1nc(N)sc1SCC#N.
What is the InChIKey of 2-[(2-amino-4-methyl-1,3-thiazol-5-yl)sulfanyl]acetonitrile?
The InChIKey is NYHFYHGWZWEWBU-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7N3S2/c1-4-5(10-3-2-7)11-6(8)9-4/h3H2,1H3,(H2,8,9).
What are the key properties of 2-[(2-amino-4-methyl-1,3-thiazol-5-yl)sulfanyl]acetonitrile?
2-[(2-amino-4-methyl-1,3-thiazol-5-yl)sulfanyl]acetonitrile has a molecular weight of 185.28 g/mol, XLogP of 1.65, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2-amino-4-methyl-1,3-thiazol-5-yl)sulfanyl]acetonitrile is sourced from PubChem (CID 24706792), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).