About 7-bromo-3,4-dihydro-1H-quinoxalin-2-one
7-bromo-3,4-dihydro-1H-quinoxalin-2-one (PubChem CID 24707978) has the molecular formula C8H7BrN2O
and a molecular weight of 227.06 g/mol. Its IUPAC name is 7-bromo-3,4-dihydro-1H-quinoxalin-2-one.
Molecular Properties
| Compound Name | 7-bromo-3,4-dihydro-1H-quinoxalin-2-one |
| PubChem CID | 24707978 |
| Molecular Formula | C8H7BrN2O |
| Molecular Weight | 227.06 g/mol |
| Exact Mass | 225.97 |
| IUPAC Name | 7-bromo-3,4-dihydro-1H-quinoxalin-2-one |
| SMILES | O=C1CNc2ccc(Br)cc2N1 |
| InChI | InChI=1S/C8H7BrN2O/c9-5-1-2-6-7(3-5)11-8(12)4-10-6/h1-3,10H,4H2,(H,11,12) |
| InChIKey | ZITQQDFTRWZLSH-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.06 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 7-bromo-3,4-dihydro-1H-quinoxalin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-bromo-3,4-dihydro-1H-quinoxalin-2-one?
The IUPAC name of 7-bromo-3,4-dihydro-1H-quinoxalin-2-one (CID 24707978) is 7-bromo-3,4-dihydro-1H-quinoxalin-2-one.
What is the SMILES notation for 7-bromo-3,4-dihydro-1H-quinoxalin-2-one?
The canonical SMILES for 7-bromo-3,4-dihydro-1H-quinoxalin-2-one is O=C1CNc2ccc(Br)cc2N1.
What is the InChIKey of 7-bromo-3,4-dihydro-1H-quinoxalin-2-one?
The InChIKey is ZITQQDFTRWZLSH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7BrN2O/c9-5-1-2-6-7(3-5)11-8(12)4-10-6/h1-3,10H,4H2,(H,11,12).
What are the key properties of 7-bromo-3,4-dihydro-1H-quinoxalin-2-one?
7-bromo-3,4-dihydro-1H-quinoxalin-2-one has a molecular weight of 227.06 g/mol, XLogP of 1.81, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-bromo-3,4-dihydro-1H-quinoxalin-2-one is sourced from PubChem (CID 24707978), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).